C26H27FN2O3 — CID 90394055
2-[[7-fluoro-2-[(1R,2S)-2-methylcyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 90394055) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[[7-fluoro-2-[(1R,2S)-2-methylcyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[7-fluoro-2-[(1R,2S)-2-methylcyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90394055 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[[7-fluoro-2-[(1R,2S)-2-methylcyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1CCCC[C@H]1C(=O)N1CCc2ccc(F)cc2C1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H27FN2O3/c1-16-6-2-3-7-19(16)24(30)28-13-12-17-10-11-18(27)14-22(17)23(28)15-29-25(31)20-8-4-5-9-21(20)26(29)32/h4-5,8-11,14,16,19,23H,2-3,6-7,12-13,15H2,1H3/t16-,19+,23?/m0/s1 |
| InChIKey | DUHRKVLXGFHYQM-PHTIXOOCSA-N |
| XLogP | 4.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|