C30H32N2O5 — CID 90394469
4-[3',6'-bis(ethylamino)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]oxybutanal (PubChem CID 90394469) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-[3',6'-bis(ethylamino)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]oxybutanal.
| Compound Name | 4-[3',6'-bis(ethylamino)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]oxybutanal |
|---|---|
| PubChem CID | 90394469 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 4-[3',6'-bis(ethylamino)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl]oxybutanal |
| SMILES | CCNc1cc2c(cc1C)C1(OC(=O)c3ccc(OCCCC=O)cc31)c1cc(C)c(NCC)cc1O2 |
| InChI | InChI=1S/C30H32N2O5/c1-5-31-25-16-27-23(13-18(25)3)30(24-14-19(4)26(32-6-2)17-28(24)36-27)22-15-20(35-12-8-7-11-33)9-10-21(22)29(34)37-30/h9-11,13-17,31-32H,5-8,12H2,1-4H3 |
| InChIKey | PGVVBFCFZNOKSO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|