C40H44O3S — CID 90394934
(2S,3R,4S,6R)-2-[5-[2-(1-benzothiophen-2-yl)propan-2-yl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxane (PubChem CID 90394934) has the molecular formula C40H44O3S and a molecular weight of 604.86 g/mol. Its IUPAC name is (2S,3R,4S,6R)-2-[5-[2-(1-benzothiophen-2-yl)propan-2-yl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,6R)-2-[5-[2-(1-benzothiophen-2-yl)propan-2-yl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 90394934 |
| Molecular Formula | C40H44O3S |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (2S,3R,4S,6R)-2-[5-[2-(1-benzothiophen-2-yl)propan-2-yl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxane |
| SMILES | CC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](c2cc(C(C)(C)c3cc4ccccc4s3)c(C)cc2C)O1 |
| InChI | InChI=1S/C40H44O3S/c1-6-32-23-35(41-25-29-15-9-7-10-16-29)39(42-26-30-17-11-8-12-18-30)38(43-32)33-24-34(28(3)21-27(33)2)40(4,5)37-22-31-19-13-14-20-36(31)44-37/h7-22,24,32,35,38-39H,6,23,25-26H2,1-5H3/t32-,35+,38+,39-/m1/s1 |
| InChIKey | WDVDNWFEMUUSMU-NYZHFDGGSA-N |
| XLogP | 10.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |