C24H24N4O — CID 90395155
N-benzyl-2-(oxan-4-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 90395155) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is N-benzyl-2-(oxan-4-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-benzyl-2-(oxan-4-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 90395155 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-benzyl-2-(oxan-4-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | c1ccc(CNc2nc(C3CCOCC3)nn3ccc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C24H24N4O/c1-3-7-18(8-4-1)17-25-24-22-21(19-9-5-2-6-10-19)11-14-28(22)27-23(26-24)20-12-15-29-16-13-20/h1-11,14,20H,12-13,15-17H2,(H,25,26,27) |
| InChIKey | BXVVVARTIIWHGB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |