C9H15N2O+ — CID 90395174
1-propan-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium (PubChem CID 90395174) has the molecular formula C9H15N2O+ and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-propan-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium.
| Compound Name | 1-propan-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 90395174 |
| Molecular Formula | C9H15N2O+ |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1-propan-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-4-ium |
| SMILES | CC(C)n1cc[n+]2c1COCC2 |
| InChI | InChI=1S/C9H15N2O/c1-8(2)11-4-3-10-5-6-12-7-9(10)11/h3-4,8H,5-7H2,1-2H3/q+1 |
| InChIKey | LVZWOUNZISUUFG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|