About 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium
5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium (PubChem CID 90395186) has the molecular formula C10H15N2+
and a molecular weight of 163.24 g/mol. Its IUPAC name is 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium.
Molecular Properties
| Compound Name | 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium |
| PubChem CID | 90395186 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium |
| SMILES | CC(C)[n+]1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C10H15N2/c1-8(2)12-4-3-9-5-11-6-10(9)7-12/h3-4,7-8,11H,5-6H2,1-2H3/q+1 |
| InChIKey | BNHRONXNGYZASO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium?
The IUPAC name of 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium (CID 90395186) is 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium.
What is the SMILES notation for 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium?
The canonical SMILES for 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium is CC(C)[n+]1ccc2c(c1)CNC2.
What is the InChIKey of 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium?
The InChIKey is BNHRONXNGYZASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2/c1-8(2)12-4-3-9-5-11-6-10(9)7-12/h3-4,7-8,11H,5-6H2,1-2H3/q+1.
What are the key properties of 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium?
5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium has a molecular weight of 163.24 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-5-ium is sourced from PubChem (CID 90395186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).