About 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione
1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione (PubChem CID 90395251) has the molecular formula C27H28N2O6
and a molecular weight of 476.53 g/mol. Its IUPAC name is 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione.
Molecular Properties
| Compound Name | 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione |
| PubChem CID | 90395251 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione |
| SMILES | COc1ccc(COc2ccc(CN3CCNC(=O)C3=O)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O6/c1-32-22-8-3-19(4-9-22)17-34-24-12-7-21(16-29-14-13-28-26(30)27(29)31)15-25(24)35-18-20-5-10-23(33-2)11-6-20/h3-12,15H,13-14,16-18H2,1-2H3,(H,28,30) |
| InChIKey | ASKPSUYFAPDQEL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione?
The IUPAC name of 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione (CID 90395251) is 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione.
What is the SMILES notation for 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione?
The canonical SMILES for 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione is COc1ccc(COc2ccc(CN3CCNC(=O)C3=O)cc2OCc2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione?
The InChIKey is ASKPSUYFAPDQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O6/c1-32-22-8-3-19(4-9-22)17-34-24-12-7-21(16-29-14-13-28-26(30)27(29)31)15-25(24)35-18-20-5-10-23(33-2)11-6-20/h3-12,15H,13-14,16-18H2,1-2H3,(H,28,30).
What are the key properties of 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione?
1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione has a molecular weight of 476.53 g/mol, XLogP of 3.32, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methyl]piperazine-2,3-dione is sourced from PubChem (CID 90395251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).