About trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide
trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide (PubChem CID 90395362) has the molecular formula C7H6N4OS
and a molecular weight of 194.22 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide |
| PubChem CID | 90395362 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)[C@H]1C[C@@H]1c1cncs1 |
| InChI | InChI=1S/C7H6N4OS/c8-11-10-7(12)5-1-4(5)6-2-9-3-13-6/h2-5H,1H2/t4-,5-/m0/s1 |
| InChIKey | PEUTXOIMCBEYSK-WHFBIAKZSA-N |
| XLogP | 2.08 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide?
The IUPAC name of trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide (CID 90395362) is trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide.
What is the SMILES notation for trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide?
The canonical SMILES for trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide is [N-]=[N+]=NC(=O)[C@H]1C[C@@H]1c1cncs1.
What is the InChIKey of trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide?
The InChIKey is PEUTXOIMCBEYSK-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H6N4OS/c8-11-10-7(12)5-1-4(5)6-2-9-3-13-6/h2-5H,1H2/t4-,5-/m0/s1.
What are the key properties of trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide?
trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide has a molecular weight of 194.22 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(1,3-thiazol-5-yl)cyclopropane-1-carbonyl azide is sourced from PubChem (CID 90395362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).