About 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine
4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine (PubChem CID 90395380) has the molecular formula C19H28N2O
and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine |
| PubChem CID | 90395380 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine |
| SMILES | c1ccc([C@H]2C[C@@H]2NC2CCC(N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O/c1-2-4-15(5-3-1)18-14-19(18)20-16-6-8-17(9-7-16)21-10-12-22-13-11-21/h1-5,16-20H,6-14H2/t16?,17?,18-,19+/m1/s1 |
| InChIKey | KELVXSSXVHPRDE-GMNCBBECSA-N |
| XLogP | 2.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine?
The IUPAC name of 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine (CID 90395380) is 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine.
What is the SMILES notation for 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine?
The canonical SMILES for 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine is c1ccc([C@H]2C[C@@H]2NC2CCC(N3CCOCC3)CC2)cc1.
What is the InChIKey of 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine?
The InChIKey is KELVXSSXVHPRDE-GMNCBBECSA-N. The full InChI is InChI=1S/C19H28N2O/c1-2-4-15(5-3-1)18-14-19(18)20-16-6-8-17(9-7-16)21-10-12-22-13-11-21/h1-5,16-20H,6-14H2/t16?,17?,18-,19+/m1/s1.
What are the key properties of 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine?
4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine has a molecular weight of 300.45 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-yl-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexan-1-amine is sourced from PubChem (CID 90395380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).