C15H24O4S2 — CID 90395561
2,4-bis(methylsulfonyl)-1-(2,3,3-trimethylbutan-2-yl)benzene (PubChem CID 90395561) has the molecular formula C15H24O4S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2,4-bis(methylsulfonyl)-1-(2,3,3-trimethylbutan-2-yl)benzene.
| Compound Name | 2,4-bis(methylsulfonyl)-1-(2,3,3-trimethylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 90395561 |
| Molecular Formula | C15H24O4S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2,4-bis(methylsulfonyl)-1-(2,3,3-trimethylbutan-2-yl)benzene |
| SMILES | CC(C)(C)C(C)(C)c1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C15H24O4S2/c1-14(2,3)15(4,5)12-9-8-11(20(6,16)17)10-13(12)21(7,18)19/h8-10H,1-7H3 |
| InChIKey | VTNSVKVDPQAXHE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |