C35H47N2O10S2+ — CID 90396070
6-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-5-sulfoindol-1-ium-2-yl)prop-2-enylidene]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 90396070) has the molecular formula C35H47N2O10S2+ and a molecular weight of 719.90 g/mol. Its IUPAC name is 6-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-5-sulfoindol-1-ium-2-yl)prop-2-enylidene]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-5-sulfoindol-1-ium-2-yl)prop-2-enylidene]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 90396070 |
| Molecular Formula | C35H47N2O10S2+ |
| Molecular Weight | 719.90 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | 6-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-5-sulfoindol-1-ium-2-yl)prop-2-enylidene]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CC[N+]1=C(/C=C/C=C2/N(CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)CCOCCOC)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C35H46N2O10S2/c1-6-36-29-16-14-25(48(40,41)42)23-27(29)34(2,3)31(36)11-10-12-32-35(4,18-20-47-22-21-46-5)28-24-26(49(43,44)45)15-17-30(28)37(32)19-9-7-8-13-33(38)39/h10-12,14-17,23-24H,6-9,13,18-22H2,1-5H3,(H2-,38,39,40,41,42,43,44,45)/p+1 |
| InChIKey | PIUARNUSTCSSLP-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|