About 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate
1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate (PubChem CID 90396455) has the molecular formula C12H21NO6
and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate.
Molecular Properties
| Compound Name | 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate |
| PubChem CID | 90396455 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate |
| SMILES | CCCCOC(=O)C[C@H](N)CC(=O)OCOC(C)=O |
| InChI | InChI=1S/C12H21NO6/c1-3-4-5-17-11(15)6-10(13)7-12(16)19-8-18-9(2)14/h10H,3-8,13H2,1-2H3/t10-/m0/s1 |
| InChIKey | QLAOXYLYMFOONX-JTQLQIEISA-N |
| XLogP | 0.50 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate?
The IUPAC name of 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate (CID 90396455) is 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate.
What is the SMILES notation for 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate?
The canonical SMILES for 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate is CCCCOC(=O)C[C@H](N)CC(=O)OCOC(C)=O.
What is the InChIKey of 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate?
The InChIKey is QLAOXYLYMFOONX-JTQLQIEISA-N. The full InChI is InChI=1S/C12H21NO6/c1-3-4-5-17-11(15)6-10(13)7-12(16)19-8-18-9(2)14/h10H,3-8,13H2,1-2H3/t10-/m0/s1.
What are the key properties of 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate?
1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate has a molecular weight of 275.30 g/mol, XLogP of 0.50, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(acetyloxymethyl) 5-O-butyl (3S)-3-aminopentanedioate is sourced from PubChem (CID 90396455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).