C15H21NO2 — CID 903969
(E)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 903969) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (E)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 903969 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (E)-1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2C[C@H](C)C[C@H](C)C2)o1 |
| InChI | InChI=1S/C15H21NO2/c1-11-8-12(2)10-16(9-11)15(17)7-6-14-5-4-13(3)18-14/h4-7,11-12H,8-10H2,1-3H3/b7-6+/t11-,12+ |
| InChIKey | QXBTWHIKAPGJQH-PKRZQGHMSA-N |
| XLogP | 3.11 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|