About 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine
1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine (PubChem CID 90396949) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine |
| PubChem CID | 90396949 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine |
| SMILES | CNC1CCC(N[C@H]2C[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2/c1-17-13-7-9-14(10-8-13)18-16-11-15(16)12-5-3-2-4-6-12/h2-6,13-18H,7-11H2,1H3/t13?,14?,15-,16+/m1/s1 |
| InChIKey | ZRCDNYZZNYQDNU-FJBKBRRZSA-N |
| XLogP | 2.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine?
The IUPAC name of 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine (CID 90396949) is 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine?
The canonical SMILES for 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine is CNC1CCC(N[C@H]2C[C@@H]2c2ccccc2)CC1.
What is the InChIKey of 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine?
The InChIKey is ZRCDNYZZNYQDNU-FJBKBRRZSA-N. The full InChI is InChI=1S/C16H24N2/c1-17-13-7-9-14(10-8-13)18-16-11-15(16)12-5-3-2-4-6-12/h2-6,13-18H,7-11H2,1H3/t13?,14?,15-,16+/m1/s1.
What are the key properties of 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine?
1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine has a molecular weight of 244.38 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 90396949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).