C28H48N2O5S — CID 90397137
(7S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-N-[(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-1-en-3-yl]-5-oxotridecanamide (PubChem CID 90397137) has the molecular formula C28H48N2O5S and a molecular weight of 524.77 g/mol. Its IUPAC name is (7S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-N-[(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-1-en-3-yl]-5-oxotridecanamide.
| Compound Name | (7S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-N-[(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-1-en-3-yl]-5-oxotridecanamide |
|---|---|
| PubChem CID | 90397137 |
| Molecular Formula | C28H48N2O5S |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | (7S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-N-[(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)pent-1-en-3-yl]-5-oxotridecanamide |
| SMILES | CC[C@H](NC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)C(C)CCCC(C)(C)O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C28H48N2O5S/c1-10-22(18(3)14-21-16-36-20(5)29-21)30-24(32)15-23(31)28(8,9)26(34)19(4)25(33)17(2)12-11-13-27(6,7)35/h14,16-17,19,22-23,25,31,33,35H,10-13,15H2,1-9H3,(H,30,32)/b18-14+/t17?,19?,22-,23?,25-/m0/s1 |
| InChIKey | XQVPJVHRAAHPQM-OFFODVJJSA-N |
| XLogP | 4.67 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |