C7H12OS — CID 90397374
3,5,6-trimethyl-2,3-dihydro-1,4-oxathiine (PubChem CID 90397374) has the molecular formula C7H12OS and a molecular weight of 144.24 g/mol. Its IUPAC name is 3,5,6-trimethyl-2,3-dihydro-1,4-oxathiine.
| Compound Name | 3,5,6-trimethyl-2,3-dihydro-1,4-oxathiine |
|---|---|
| PubChem CID | 90397374 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 3,5,6-trimethyl-2,3-dihydro-1,4-oxathiine |
| SMILES | CC1=C(C)SC(C)CO1 |
| InChI | InChI=1S/C7H12OS/c1-5-4-8-6(2)7(3)9-5/h5H,4H2,1-3H3 |
| InChIKey | BVOZERDPLSIMKS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |