C41H30F6S2 — CID 90397587
3-[2-[2,5-bis(4-methylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methylphenyl)thiophene (PubChem CID 90397587) has the molecular formula C41H30F6S2 and a molecular weight of 700.81 g/mol. Its IUPAC name is 3-[2-[2,5-bis(4-methylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methylphenyl)thiophene.
| Compound Name | 3-[2-[2,5-bis(4-methylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methylphenyl)thiophene |
|---|---|
| PubChem CID | 90397587 |
| Molecular Formula | C41H30F6S2 |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | 3-[2-[2,5-bis(4-methylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methylphenyl)thiophene |
| SMILES | Cc1ccc(-c2cc(C3=C(c4cc(-c5ccc(C)cc5)sc4-c4ccc(C)cc4)C(F)(F)C(F)(F)C3(F)F)c(-c3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C41H30F6S2/c1-23-5-13-27(14-6-23)33-21-31(37(48-33)29-17-9-25(3)10-18-29)35-36(40(44,45)41(46,47)39(35,42)43)32-22-34(28-15-7-24(2)8-16-28)49-38(32)30-19-11-26(4)12-20-30/h5-22H,1-4H3 |
| InChIKey | HSNAMVNAHMKAEW-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|