C32H42N2O2Si — CID 90397715
[(3S)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 90397715) has the molecular formula C32H42N2O2Si and a molecular weight of 514.79 g/mol. Its IUPAC name is [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 90397715 |
| Molecular Formula | C32H42N2O2Si |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)C13CCNC(C2)C12CCC1C3[C@@H](CN1C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C32H42N2O2Si/c1-30(2,3)37(4,5)36-24-12-11-22-17-27-31-14-13-26-28(32(31,15-16-33-27)25(22)18-24)23(19-31)20-34(26)29(35)21-9-7-6-8-10-21/h6-12,18,23,26-28,33H,13-17,19-20H2,1-5H3/t23-,26?,27?,28?,31?,32?/m1/s1 |
| InChIKey | GFPICPUNXXVTKY-OYPYEWGJSA-N |
| XLogP | 6.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|