C28H37N5O — CID 90397730
(3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-[2-(methylamino)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 90397730) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-[2-(methylamino)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-[2-(methylamino)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 90397730 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-[2-(methylamino)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | CNCCN1CCC23c4cc(O)ccc4CC1C21CCC2C3[C@@H](CN2c2nc(C)cc(C)n2)C1 |
| InChI | InChI=1S/C28H37N5O/c1-17-12-18(2)31-26(30-17)33-16-20-15-27-7-6-23(33)25(20)28(27)8-10-32(11-9-29-3)24(27)13-19-4-5-21(34)14-22(19)28/h4-5,12,14,20,23-25,29,34H,6-11,13,15-16H2,1-3H3/t20-,23?,24?,25?,27?,28?/m1/s1 |
| InChIKey | BJWIQLWWEXEEIR-FHRHOYQYSA-N |
| XLogP | 3.19 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |