C21H24N10O2 — CID 90397888
trans-(1R,3R)-3-[amino-[3-[4-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentane-1-carboxamide (PubChem CID 90397888) has the molecular formula C21H24N10O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is trans-(1R,3R)-3-[amino-[3-[4-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentane-1-carboxamide.
| Compound Name | trans-(1R,3R)-3-[amino-[3-[4-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90397888 |
| Molecular Formula | C21H24N10O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | trans-(1R,3R)-3-[amino-[3-[4-[1-(2-hydroxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CC[C@@H](N(N)c2ncc3nnn(-c4ccc(-c5cnn(CCO)c5)cc4)c3n2)C1 |
| InChI | InChI=1S/C21H24N10O2/c22-19(33)14-3-6-17(9-14)30(23)21-24-11-18-20(26-21)31(28-27-18)16-4-1-13(2-5-16)15-10-25-29(12-15)7-8-32/h1-2,4-5,10-12,14,17,32H,3,6-9,23H2,(H2,22,33)/t14-,17-/m1/s1 |
| InChIKey | BSOHMXMTZWCIPG-RHSMWYFYSA-N |
| XLogP | 0.40 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|