C21H23N9O — CID 90397901
trans-(1R,3R)-3-[[3-[4-[1-(3-iminopropyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol (PubChem CID 90397901) has the molecular formula C21H23N9O and a molecular weight of 417.48 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[3-[4-[1-(3-iminopropyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,3R)-3-[[3-[4-[1-(3-iminopropyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 90397901 |
| Molecular Formula | C21H23N9O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | trans-(1R,3R)-3-[[3-[4-[1-(3-iminopropyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
| SMILES | [H]/N=C/CCn1cc(-c2ccc(-n3nnc4cnc(N[C@@H]5CC[C@@H](O)C5)nc43)cc2)cn1 |
| InChI | InChI=1S/C21H23N9O/c22-8-1-9-29-13-15(11-24-29)14-2-5-17(6-3-14)30-20-19(27-28-30)12-23-21(26-20)25-16-4-7-18(31)10-16/h2-3,5-6,8,11-13,16,18,22,31H,1,4,7,9-10H2,(H,23,25,26)/b22-8+/t16-,18-/m1/s1 |
| InChIKey | RJFWONOBAMICDP-DFFSTIJDSA-N |
| XLogP | 2.44 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|