C19H24N2O2S — CID 9039794
2-[(2-methoxy-5-methylphenyl)methyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 9039794) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylphenyl)methyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(2-methoxy-5-methylphenyl)methyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 9039794 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[(2-methoxy-5-methylphenyl)methyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1CN(C)CC(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C19H24N2O2S/c1-14-9-10-17(23-3)15(11-14)12-21(2)13-19(22)20-16-7-5-6-8-18(16)24-4/h5-11H,12-13H2,1-4H3,(H,20,22) |
| InChIKey | NUTADSGQCNCHIQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |