C27H40N6O2Si — CID 90398222
2-[[3-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90398222) has the molecular formula C27H40N6O2Si and a molecular weight of 508.74 g/mol. Its IUPAC name is 2-[[3-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90398222 |
| Molecular Formula | C27H40N6O2Si |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-[[3-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[C@@H]1CN(c2cc(-c3c4cc(OC5(C)CC5)ccc4nn3COCC[Si](C)(C)C)ncn2)C[C@H](C)N1 |
| InChI | InChI=1S/C27H40N6O2Si/c1-19-15-32(16-20(2)30-19)25-14-24(28-17-29-25)26-22-13-21(35-27(3)9-10-27)7-8-23(22)31-33(26)18-34-11-12-36(4,5)6/h7-8,13-14,17,19-20,30H,9-12,15-16,18H2,1-6H3/t19-,20+ |
| InChIKey | ZWYBLWVLYAEUNU-BGYRXZFFSA-N |
| XLogP | 4.92 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|