About 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole
3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole (PubChem CID 90398577) has the molecular formula C20H17F2N5O
and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole.
Molecular Properties
| Compound Name | 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole |
| PubChem CID | 90398577 |
| Molecular Formula | C20H17F2N5O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole |
| SMILES | FC1(F)CCN(c2cc(-c3n[nH]c4ccc(-c5ccoc5)cc34)ncn2)CC1 |
| InChI | InChI=1S/C20H17F2N5O/c21-20(22)4-6-27(7-5-20)18-10-17(23-12-24-18)19-15-9-13(14-3-8-28-11-14)1-2-16(15)25-26-19/h1-3,8-12H,4-7H2,(H,25,26) |
| InChIKey | IYITYXHAJQSYLI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole?
The IUPAC name of 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole (CID 90398577) is 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole.
What is the SMILES notation for 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole?
The canonical SMILES for 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole is FC1(F)CCN(c2cc(-c3n[nH]c4ccc(-c5ccoc5)cc34)ncn2)CC1.
What is the InChIKey of 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole?
The InChIKey is IYITYXHAJQSYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N5O/c21-20(22)4-6-27(7-5-20)18-10-17(23-12-24-18)19-15-9-13(14-3-8-28-11-14)1-2-16(15)25-26-19/h1-3,8-12H,4-7H2,(H,25,26).
What are the key properties of 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole?
3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole has a molecular weight of 381.39 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]-5-(furan-3-yl)-1H-indazole is sourced from PubChem (CID 90398577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).