About 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide
4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide (PubChem CID 90398688) has the molecular formula C18H20FN5O2S
and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide |
| PubChem CID | 90398688 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide |
| SMILES | CC(C)Oc1cc2c(-c3cc(N4CCS(=O)CC4)ncn3)n[nH]c2cc1F |
| InChI | InChI=1S/C18H20FN5O2S/c1-11(2)26-16-7-12-14(8-13(16)19)22-23-18(12)15-9-17(21-10-20-15)24-3-5-27(25)6-4-24/h7-11H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | PTLYPUQTGZQDAJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide?
The IUPAC name of 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide (CID 90398688) is 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide.
What is the SMILES notation for 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide?
The canonical SMILES for 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide is CC(C)Oc1cc2c(-c3cc(N4CCS(=O)CC4)ncn3)n[nH]c2cc1F.
What is the InChIKey of 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide?
The InChIKey is PTLYPUQTGZQDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O2S/c1-11(2)26-16-7-12-14(8-13(16)19)22-23-18(12)15-9-17(21-10-20-15)24-3-5-27(25)6-4-24/h7-11H,3-6H2,1-2H3,(H,22,23).
What are the key properties of 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide?
4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide has a molecular weight of 389.46 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(6-fluoro-5-propan-2-yloxy-1H-indazol-3-yl)pyrimidin-4-yl]-1,4-thiazinane 1-oxide is sourced from PubChem (CID 90398688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).