About CID 90399018
CID 90399018 (PubChem CID 90399018) has the molecular formula C7H4BNS
and a molecular weight of 144.99 g/mol.
Molecular Properties
| Compound Name | CID 90399018 |
| PubChem CID | 90399018 |
| Molecular Formula | C7H4BNS |
| Molecular Weight | 144.99 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | — |
| SMILES | [B]c1cc2ccncc2s1 |
| InChI | InChI=1S/C7H4BNS/c8-7-3-5-1-2-9-4-6(5)10-7/h1-4H |
| InChIKey | MFIXRKZASUPJEC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.99 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90399018 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90399018?
The IUPAC name of CID 90399018 (CID 90399018) is not available.
What is the SMILES notation for CID 90399018?
The canonical SMILES for CID 90399018 is [B]c1cc2ccncc2s1.
What is the InChIKey of CID 90399018?
The InChIKey is MFIXRKZASUPJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BNS/c8-7-3-5-1-2-9-4-6(5)10-7/h1-4H.
What are the key properties of CID 90399018?
CID 90399018 has a molecular weight of 144.99 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90399018 is sourced from PubChem (CID 90399018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).