C20H18ClF3N5O4+ — CID 90399249
methyl 6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-1-hydroxypyridin-1-ium-3-carboxylate (PubChem CID 90399249) has the molecular formula C20H18ClF3N5O4+ and a molecular weight of 484.84 g/mol. Its IUPAC name is methyl 6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-1-hydroxypyridin-1-ium-3-carboxylate.
| Compound Name | methyl 6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-1-hydroxypyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 90399249 |
| Molecular Formula | C20H18ClF3N5O4+ |
| Molecular Weight | 484.84 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | methyl 6-[[6-[(4-chlorophenyl)methylamino]-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-1-hydroxypyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2cc(NCc3ccc(Cl)cc3)nc(OCC(F)(F)F)n2)[n+](O)c1 |
| InChI | InChI=1S/C20H17ClF3N5O4/c1-32-18(30)13-4-7-17(29(31)10-13)26-16-8-15(25-9-12-2-5-14(21)6-3-12)27-19(28-16)33-11-20(22,23)24/h2-8,10,31H,9,11H2,1H3,(H,25,27,28)/p+1 |
| InChIKey | IGRPOXSJPZJHOQ-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|