C38H28N2O6 — CID 90399565
5,6,17,18-tetramethoxy-9,21-diphenyl-11,23-diazahexacyclo[11.11.0.02,11.03,8.014,23.015,20]tetracosa-1,3,5,7,9,13,15,17,19,21-decaene-12,24-dione (PubChem CID 90399565) has the molecular formula C38H28N2O6 and a molecular weight of 608.65 g/mol. Its IUPAC name is 5,6,17,18-tetramethoxy-9,21-diphenyl-11,23-diazahexacyclo[11.11.0.02,11.03,8.014,23.015,20]tetracosa-1,3,5,7,9,13,15,17,19,21-decaene-12,24-dione.
| Compound Name | 5,6,17,18-tetramethoxy-9,21-diphenyl-11,23-diazahexacyclo[11.11.0.02,11.03,8.014,23.015,20]tetracosa-1,3,5,7,9,13,15,17,19,21-decaene-12,24-dione |
|---|---|
| PubChem CID | 90399565 |
| Molecular Formula | C38H28N2O6 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 5,6,17,18-tetramethoxy-9,21-diphenyl-11,23-diazahexacyclo[11.11.0.02,11.03,8.014,23.015,20]tetracosa-1,3,5,7,9,13,15,17,19,21-decaene-12,24-dione |
| SMILES | COc1cc2c(cc1OC)C1=C3C(=O)N4C=C(c5ccccc5)c5cc(OC)c(OC)cc5C4=C3C(=O)N1C=C2c1ccccc1 |
| InChI | InChI=1S/C38H28N2O6/c1-43-29-15-23-25(17-31(29)45-3)35-33-34(38(42)39(35)19-27(23)21-11-7-5-8-12-21)36-26-18-32(46-4)30(44-2)16-24(26)28(20-40(36)37(33)41)22-13-9-6-10-14-22/h5-20H,1-4H3 |
| InChIKey | KAEWIOQNCQVFTG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|