About (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine
(1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine (PubChem CID 90400061) has the molecular formula C20H24N6O
and a molecular weight of 364.45 g/mol. Its IUPAC name is (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine |
| PubChem CID | 90400061 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C(\N)N1CCOCC1)c1nn(C)c2ccc(-c3cnn(C)c3)cc12 |
| InChI | InChI=1S/C20H24N6O/c1-14(10-19(21)26-6-8-27-9-7-26)20-17-11-15(16-12-22-24(2)13-16)4-5-18(17)25(3)23-20/h4-5,10-13H,1,6-9,21H2,2-3H3/b19-10+ |
| InChIKey | GAPGRLVPIHIMJV-VXLYETTFSA-N |
| XLogP | 2.12 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine?
The IUPAC name of (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine (CID 90400061) is (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine?
The canonical SMILES for (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine is C=C(/C=C(\N)N1CCOCC1)c1nn(C)c2ccc(-c3cnn(C)c3)cc12.
What is the InChIKey of (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine?
The InChIKey is GAPGRLVPIHIMJV-VXLYETTFSA-N. The full InChI is InChI=1S/C20H24N6O/c1-14(10-19(21)26-6-8-27-9-7-26)20-17-11-15(16-12-22-24(2)13-16)4-5-18(17)25(3)23-20/h4-5,10-13H,1,6-9,21H2,2-3H3/b19-10+.
What are the key properties of (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine?
(1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine has a molecular weight of 364.45 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-3-[1-methyl-5-(1-methylpyrazol-4-yl)indazol-3-yl]-1-morpholin-4-ylbuta-1,3-dien-1-amine is sourced from PubChem (CID 90400061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).