About 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole
5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole (PubChem CID 90400216) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole |
| PubChem CID | 90400216 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole |
| SMILES | Cc1nc(C2CCOCC2)ns1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-9-8(10-12-6)7-2-4-11-5-3-7/h7H,2-5H2,1H3 |
| InChIKey | HUPZISOLQGQOLH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole?
The IUPAC name of 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole (CID 90400216) is 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole?
The canonical SMILES for 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole is Cc1nc(C2CCOCC2)ns1.
What is the InChIKey of 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole?
The InChIKey is HUPZISOLQGQOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-6-9-8(10-12-6)7-2-4-11-5-3-7/h7H,2-5H2,1H3.
What are the key properties of 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole?
5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole has a molecular weight of 184.26 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(oxan-4-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 90400216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).