C24H32F2N6O — CID 90400269
[2-[1-[6-[(3R)-4-(1,1-difluoropropan-2-yl)-3-methylpiperazin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine (PubChem CID 90400269) has the molecular formula C24H32F2N6O and a molecular weight of 458.56 g/mol. Its IUPAC name is [2-[1-[6-[(3R)-4-(1,1-difluoropropan-2-yl)-3-methylpiperazin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine.
| Compound Name | [2-[1-[6-[(3R)-4-(1,1-difluoropropan-2-yl)-3-methylpiperazin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine |
|---|---|
| PubChem CID | 90400269 |
| Molecular Formula | C24H32F2N6O |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | [2-[1-[6-[(3R)-4-(1,1-difluoropropan-2-yl)-3-methylpiperazin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine |
| SMILES | C=C(c1cc(N2CCN(C(C)C(F)F)[C@H](C)C2)ncn1)c1cc(OC2(C)CC2)ccc1NN |
| InChI | InChI=1S/C24H32F2N6O/c1-15-13-31(9-10-32(15)17(3)23(25)26)22-12-21(28-14-29-22)16(2)19-11-18(5-6-20(19)30-27)33-24(4)7-8-24/h5-6,11-12,14-15,17,23,30H,2,7-10,13,27H2,1,3-4H3/t15-,17?/m1/s1 |
| InChIKey | IASOSMLSSOEMPV-LDCVWXEPSA-N |
| XLogP | 3.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|