C41H40BFN4O3 — CID 90400747
4-[4-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-yl]-2-pyridinyl]morpholine (PubChem CID 90400747) has the molecular formula C41H40BFN4O3 and a molecular weight of 666.61 g/mol. Its IUPAC name is 4-[4-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[4-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 90400747 |
| Molecular Formula | C41H40BFN4O3 |
| Molecular Weight | 666.61 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | 4-[4-[6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-yl]-2-pyridinyl]morpholine |
| SMILES | CC1(C)OB(c2cc3c(-c4ccnc(N5CCOCC5)c4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2F)OC1(C)C |
| InChI | InChI=1S/C41H40BFN4O3/c1-39(2)40(3,4)50-42(49-39)34-27-33-36(28-35(34)43)47(45-38(33)29-20-21-44-37(26-29)46-22-24-48-25-23-46)41(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-21,26-28H,22-25H2,1-4H3 |
| InChIKey | YDLQZJPPEJGXHL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|