C40H37BF2N4O2 — CID 90400936
6-fluoro-3-[2-(3-fluoroazetidin-1-yl)-4-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazole (PubChem CID 90400936) has the molecular formula C40H37BF2N4O2 and a molecular weight of 654.57 g/mol. Its IUPAC name is 6-fluoro-3-[2-(3-fluoroazetidin-1-yl)-4-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazole.
| Compound Name | 6-fluoro-3-[2-(3-fluoroazetidin-1-yl)-4-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazole |
|---|---|
| PubChem CID | 90400936 |
| Molecular Formula | C40H37BF2N4O2 |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 6-fluoro-3-[2-(3-fluoroazetidin-1-yl)-4-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazole |
| SMILES | CC1(C)OB(c2cc3c(-c4ccnc(N5CC(F)C5)c4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2F)OC1(C)C |
| InChI | InChI=1S/C40H37BF2N4O2/c1-38(2)39(3,4)49-41(48-38)33-23-32-35(24-34(33)43)47(45-37(32)27-20-21-44-36(22-27)46-25-31(42)26-46)40(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-24,31H,25-26H2,1-4H3 |
| InChIKey | SIJLFJDDOYTUIT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|