C18H42O6Si3 — CID 90401101
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilylmethyl)silyl]propoxy]oxane-3,4,5-triol (PubChem CID 90401101) has the molecular formula C18H42O6Si3 and a molecular weight of 438.79 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilylmethyl)silyl]propoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilylmethyl)silyl]propoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90401101 |
| Molecular Formula | C18H42O6Si3 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilylmethyl)silyl]propoxy]oxane-3,4,5-triol |
| SMILES | C[Si](C)(C)C[Si](C)(CCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H42O6Si3/c1-25(2,3)12-27(7,13-26(4,5)6)10-8-9-23-18-17(22)16(21)15(20)14(11-19)24-18/h14-22H,8-13H2,1-7H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | DZJWTDHIMLRUPH-UYTYNIKBSA-N |
| XLogP | 2.03 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|