C12H14FN3O — CID 90401251
(1S,5R,6S)-5-(5-amino-2-fluorophenyl)-5-methyl-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 90401251) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is (1S,5R,6S)-5-(5-amino-2-fluorophenyl)-5-methyl-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5R,6S)-5-(5-amino-2-fluorophenyl)-5-methyl-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 90401251 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (1S,5R,6S)-5-(5-amino-2-fluorophenyl)-5-methyl-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)N=C(N)O[C@H]2C[C@H]21 |
| InChI | InChI=1S/C12H14FN3O/c1-12(7-4-6(14)2-3-9(7)13)8-5-10(8)17-11(15)16-12/h2-4,8,10H,5,14H2,1H3,(H2,15,16)/t8-,10+,12+/m1/s1 |
| InChIKey | MAQKTMHYKWOHLZ-QRTLGDNMSA-N |
| XLogP | 1.36 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|