About 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide
2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide (PubChem CID 90401469) has the molecular formula C12H22O6S3
and a molecular weight of 358.50 g/mol. Its IUPAC name is 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide |
| PubChem CID | 90401469 |
| Molecular Formula | C12H22O6S3 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide |
| SMILES | CCC1C(S(=O)(=O)C2CCS(=O)(=O)C2CC)CCS1(=O)=O |
| InChI | InChI=1S/C12H22O6S3/c1-3-9-11(5-7-19(9,13)14)21(17,18)12-6-8-20(15,16)10(12)4-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | LCRWCMXGNQBJEF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide?
The IUPAC name of 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide (CID 90401469) is 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide.
What is the SMILES notation for 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide?
The canonical SMILES for 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide is CCC1C(S(=O)(=O)C2CCS(=O)(=O)C2CC)CCS1(=O)=O.
What is the InChIKey of 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide?
The InChIKey is LCRWCMXGNQBJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6S3/c1-3-9-11(5-7-19(9,13)14)21(17,18)12-6-8-20(15,16)10(12)4-2/h9-12H,3-8H2,1-2H3.
What are the key properties of 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide?
2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide has a molecular weight of 358.50 g/mol, XLogP of 0.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-(2-ethyl-1,1-dioxothiolan-3-yl)sulfonylthiolane 1,1-dioxide is sourced from PubChem (CID 90401469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).