C53H43N7 — CID 90401578
2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 90401578) has the molecular formula C53H43N7 and a molecular weight of 777.98 g/mol. Its IUPAC name is 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 90401578 |
| Molecular Formula | C53H43N7 |
| Molecular Weight | 777.98 g/mol |
| Exact Mass | 777.36 |
| IUPAC Name | 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cc(-c4ccc5ccc6cccnc6c5n4)cc(-c4ccc5ccc6cccnc6c5n4)c3)n2)cc1 |
| InChI | InChI=1S/C53H43N7/c1-52(2,3)41-21-15-36(16-22-41)49-58-50(37-17-23-42(24-18-37)53(4,5)6)60-51(59-49)40-30-38(43-25-19-34-13-11-32-9-7-27-54-45(32)47(34)56-43)29-39(31-40)44-26-20-35-14-12-33-10-8-28-55-46(33)48(35)57-44/h7-31H,1-6H3 |
| InChIKey | ZROPSQNWNHHLLL-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.98 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|