About 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide
3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide (PubChem CID 90401608) has the molecular formula C14H22O5S2
and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide |
| PubChem CID | 90401608 |
| Molecular Formula | C14H22O5S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide |
| SMILES | C=CCC1C(OC2CCS(=O)(=O)C2CC=C)CCS1(=O)=O |
| InChI | InChI=1S/C14H22O5S2/c1-3-5-13-11(7-9-20(13,15)16)19-12-8-10-21(17,18)14(12)6-4-2/h3-4,11-14H,1-2,5-10H2 |
| InChIKey | GGSIBVXESZHWAE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide?
The IUPAC name of 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide (CID 90401608) is 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide.
What is the SMILES notation for 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide?
The canonical SMILES for 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide is C=CCC1C(OC2CCS(=O)(=O)C2CC=C)CCS1(=O)=O.
What is the InChIKey of 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide?
The InChIKey is GGSIBVXESZHWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5S2/c1-3-5-13-11(7-9-20(13,15)16)19-12-8-10-21(17,18)14(12)6-4-2/h3-4,11-14H,1-2,5-10H2.
What are the key properties of 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide?
3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide has a molecular weight of 334.46 g/mol, XLogP of 1.27, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxo-2-prop-2-enylthiolan-3-yl)oxy-2-prop-2-enylthiolane 1,1-dioxide is sourced from PubChem (CID 90401608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).