C26H25FO4S — CID 90401995
(4aR,6R,7S,8S,8aR)-8-fluoro-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 90401995) has the molecular formula C26H25FO4S and a molecular weight of 452.55 g/mol. Its IUPAC name is (4aR,6R,7S,8S,8aR)-8-fluoro-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7S,8S,8aR)-8-fluoro-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 90401995 |
| Molecular Formula | C26H25FO4S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (4aR,6R,7S,8S,8aR)-8-fluoro-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | F[C@@H]1[C@H](OCc2ccccc2)[C@@H](Sc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C26H25FO4S/c27-22-23-21(17-29-25(31-23)19-12-6-2-7-13-19)30-26(32-20-14-8-3-9-15-20)24(22)28-16-18-10-4-1-5-11-18/h1-15,21-26H,16-17H2/t21-,22+,23-,24+,25?,26-/m1/s1 |
| InChIKey | FCQZFUCHTUPRFX-XXIGIWSESA-N |
| XLogP | 5.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |