C16H28O6 — CID 90402311
[(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dec-9-enoate (PubChem CID 90402311) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dec-9-enoate.
| Compound Name | [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dec-9-enoate |
|---|---|
| PubChem CID | 90402311 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)O[C@H](CO)[C@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H28O6/c1-2-3-4-5-6-7-8-9-14(19)22-13(10-17)16-15(20)12(18)11-21-16/h2,12-13,15-18,20H,1,3-11H2/t12-,13+,15+,16+/m0/s1 |
| InChIKey | UOAKMFZCWGBOAB-SJXGUFTOSA-N |
| XLogP | 0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|