C15H22N6O2Si — CID 90402431
2-trimethylsilylethyl 3-pyrazin-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 90402431) has the molecular formula C15H22N6O2Si and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-pyrazin-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-pyrazin-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 90402431 |
| Molecular Formula | C15H22N6O2Si |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-trimethylsilylethyl 3-pyrazin-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCn2c(nnc2-c2cnccn2)C1 |
| InChI | InChI=1S/C15H22N6O2Si/c1-24(2,3)9-8-23-15(22)20-6-7-21-13(11-20)18-19-14(21)12-10-16-4-5-17-12/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | UOBXTPDONRTMLL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|