C5H8N4O — CID 90402510
5,6,7,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 90402510) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 5,6,7,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 5,6,7,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 90402510 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 5,6,7,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | O=C1NCCN2C=NNC12 |
| InChI | InChI=1S/C5H8N4O/c10-5-4-8-7-3-9(4)2-1-6-5/h3-4,8H,1-2H2,(H,6,10) |
| InChIKey | LWNSUVFFGSFZCZ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |