C25H21ClF6N4O5 — CID 90402624
8-[3,5-bis(trifluoromethyl)phenoxy]-7-[(4-chlorophenyl)methyl]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione (PubChem CID 90402624) has the molecular formula C25H21ClF6N4O5 and a molecular weight of 606.91 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenoxy]-7-[(4-chlorophenyl)methyl]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenoxy]-7-[(4-chlorophenyl)methyl]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 90402624 |
| Molecular Formula | C25H21ClF6N4O5 |
| Molecular Weight | 606.91 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenoxy]-7-[(4-chlorophenyl)methyl]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CCOCCO)c(=O)c2c1nc(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClF6N4O5/c1-34-20-19(21(38)35(23(34)39)6-8-40-9-7-37)36(13-14-2-4-17(26)5-3-14)22(33-20)41-18-11-15(24(27,28)29)10-16(12-18)25(30,31)32/h2-5,10-12,37H,6-9,13H2,1H3 |
| InChIKey | BBEYAHRURAKGHU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|