About 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione
1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 90402637) has the molecular formula C18H19F3N4O6
and a molecular weight of 444.37 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| PubChem CID | 90402637 |
| Molecular Formula | C18H19F3N4O6 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | Cn1c(OCCOc2cccc(OC(F)(F)F)c2)nc2c1c(=O)n(CCO)c(=O)n2C |
| InChI | InChI=1S/C18H19F3N4O6/c1-23-13-14(24(2)17(28)25(6-7-26)15(13)27)22-16(23)30-9-8-29-11-4-3-5-12(10-11)31-18(19,20)21/h3-5,10,26H,6-9H2,1-2H3 |
| InChIKey | LBWUKJPUDZCKQR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione?
The IUPAC name of 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (CID 90402637) is 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
What is the SMILES notation for 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione?
The canonical SMILES for 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione is Cn1c(OCCOc2cccc(OC(F)(F)F)c2)nc2c1c(=O)n(CCO)c(=O)n2C.
What is the InChIKey of 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione?
The InChIKey is LBWUKJPUDZCKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3N4O6/c1-23-13-14(24(2)17(28)25(6-7-26)15(13)27)22-16(23)30-9-8-29-11-4-3-5-12(10-11)31-18(19,20)21/h3-5,10,26H,6-9H2,1-2H3.
What are the key properties of 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione?
1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione has a molecular weight of 444.37 g/mol, XLogP of 0.78, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-3,7-dimethyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione is sourced from PubChem (CID 90402637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).