C23H20ClF3N4O4 — CID 90402683
7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-[3-(trifluoromethoxy)phenoxy]propyl]purine-2,6-dione (PubChem CID 90402683) has the molecular formula C23H20ClF3N4O4 and a molecular weight of 508.88 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-[3-(trifluoromethoxy)phenoxy]propyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-[3-(trifluoromethoxy)phenoxy]propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 90402683 |
| Molecular Formula | C23H20ClF3N4O4 |
| Molecular Weight | 508.88 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[3-[3-(trifluoromethoxy)phenoxy]propyl]purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(CCCOc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClF3N4O4/c1-30-20-19(21(32)29-22(30)33)31(13-14-7-9-15(24)10-8-14)18(28-20)6-3-11-34-16-4-2-5-17(12-16)35-23(25,26)27/h2,4-5,7-10,12H,3,6,11,13H2,1H3,(H,29,32,33) |
| InChIKey | QINWAWDCTMVVCU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|