C29H41F3N4O8Si — CID 90402773
3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90402773) has the molecular formula C29H41F3N4O8Si and a molecular weight of 658.75 g/mol. Its IUPAC name is 3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90402773 |
| Molecular Formula | C29H41F3N4O8Si |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(OCCOc1cccc(OC(F)(F)F)c1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C29H41F3N4O8Si/c1-34-25-24(26(37)35(28(34)38)12-8-14-42-23-11-5-6-13-41-23)36(20-39-17-18-45(2,3)4)27(33-25)43-16-15-40-21-9-7-10-22(19-21)44-29(30,31)32/h7,9-10,19,23H,5-6,8,11-18,20H2,1-4H3 |
| InChIKey | QTAAQBOVEGUWPJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 117.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|