C33H41F3N4O7Si — CID 90402799
7-benzyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)phenoxy]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90402799) has the molecular formula C33H41F3N4O7Si and a molecular weight of 690.79 g/mol. Its IUPAC name is 7-benzyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)phenoxy]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 7-benzyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)phenoxy]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90402799 |
| Molecular Formula | C33H41F3N4O7Si |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | 7-benzyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)phenoxy]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(Oc1cccc(OC(F)(F)F)c1)n2Cc1ccccc1 |
| InChI | InChI=1S/C33H41F3N4O7Si/c1-48(2,3)20-19-43-23-40-29-28(30(41)38(32(40)42)16-10-18-45-27-15-7-8-17-44-27)39(22-24-11-5-4-6-12-24)31(37-29)46-25-13-9-14-26(21-25)47-33(34,35)36/h4-6,9,11-14,21,27H,7-8,10,15-20,22-23H2,1-3H3 |
| InChIKey | MWBUSDMIQOJACC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 107.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|