C29H28ClF3N4O6 — CID 90402821
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione (PubChem CID 90402821) has the molecular formula C29H28ClF3N4O6 and a molecular weight of 621.01 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
|---|---|
| PubChem CID | 90402821 |
| Molecular Formula | C29H28ClF3N4O6 |
| Molecular Weight | 621.01 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(C(=O)c1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClF3N4O6/c1-35-25-23(27(39)36(28(35)40)13-5-15-42-22-8-2-3-14-41-22)37(17-18-9-11-20(30)12-10-18)26(34-25)24(38)19-6-4-7-21(16-19)43-29(31,32)33/h4,6-7,9-12,16,22H,2-3,5,8,13-15,17H2,1H3 |
| InChIKey | AUXBWOZHOQKZKL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|