C28H29ClF3N5O5 — CID 90403046
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione (PubChem CID 90403046) has the molecular formula C28H29ClF3N5O5 and a molecular weight of 608.02 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
|---|---|
| PubChem CID | 90403046 |
| Molecular Formula | C28H29ClF3N5O5 |
| Molecular Weight | 608.02 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(Nc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H29ClF3N5O5/c1-35-24-23(25(38)36(27(35)39)13-5-15-41-22-8-2-3-14-40-22)37(17-18-9-11-19(29)12-10-18)26(34-24)33-20-6-4-7-21(16-20)42-28(30,31)32/h4,6-7,9-12,16,22H,2-3,5,8,13-15,17H2,1H3,(H,33,34) |
| InChIKey | JWXKPXDIDLYYQE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|