C29H30ClF3N4O6S — CID 90403113
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione (PubChem CID 90403113) has the molecular formula C29H30ClF3N4O6S and a molecular weight of 655.10 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 90403113 |
| Molecular Formula | C29H30ClF3N4O6S |
| Molecular Weight | 655.10 g/mol |
| Exact Mass | 654.15 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[[3-(trifluoromethoxy)phenyl]methylsulfinyl]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(S(=O)Cc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H30ClF3N4O6S/c1-35-25-24(26(38)36(28(35)39)13-5-15-42-23-8-2-3-14-41-23)37(17-19-9-11-21(30)12-10-19)27(34-25)44(40)18-20-6-4-7-22(16-20)43-29(31,32)33/h4,6-7,9-12,16,23H,2-3,5,8,13-15,17-18H2,1H3 |
| InChIKey | PGVBHZZHRDAVAL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|